C14H10BrF2N3S — CID 46232969
[(Z)-[(3-bromophenyl)-(2,6-difluorophenyl)methylidene]amino]thiourea (PubChem CID 46232969) has the molecular formula C14H10BrF2N3S and a molecular weight of 370.22 g/mol. Its IUPAC name is [(Z)-[(3-bromophenyl)-(2,6-difluorophenyl)methylidene]amino]thiourea.
| Compound Name | [(Z)-[(3-bromophenyl)-(2,6-difluorophenyl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 46232969 |
| Molecular Formula | C14H10BrF2N3S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | [(Z)-[(3-bromophenyl)-(2,6-difluorophenyl)methylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C(/c1cccc(Br)c1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H10BrF2N3S/c15-9-4-1-3-8(7-9)13(19-20-14(18)21)12-10(16)5-2-6-11(12)17/h1-7H,(H3,18,20,21)/b19-13- |
| InChIKey | BSLHGVXHIOPZFK-UYRXBGFRSA-N |
| XLogP | 3.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|