C14H9Br4N3S — CID 74411431
[[(3,4-dibromophenyl)-(3,5-dibromophenyl)methylidene]amino]thiourea (PubChem CID 74411431) has the molecular formula C14H9Br4N3S and a molecular weight of 570.93 g/mol. Its IUPAC name is [[(3,4-dibromophenyl)-(3,5-dibromophenyl)methylidene]amino]thiourea.
| Compound Name | [[(3,4-dibromophenyl)-(3,5-dibromophenyl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 74411431 |
| Molecular Formula | C14H9Br4N3S |
| Molecular Weight | 570.93 g/mol |
| Exact Mass | 566.73 |
| IUPAC Name | [[(3,4-dibromophenyl)-(3,5-dibromophenyl)methylidene]amino]thiourea |
| SMILES | NC(=S)NN=C(c1cc(Br)cc(Br)c1)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C14H9Br4N3S/c15-9-3-8(4-10(16)6-9)13(20-21-14(19)22)7-1-2-11(17)12(18)5-7/h1-6H,(H3,19,21,22) |
| InChIKey | UCXFJMNUEYBANI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|