C23H26Cl2N4O2 — CID 46234751
8-chloro-1-[4-(3-methoxyphenoxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride (PubChem CID 46234751) has the molecular formula C23H26Cl2N4O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 8-chloro-1-[4-(3-methoxyphenoxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride.
| Compound Name | 8-chloro-1-[4-(3-methoxyphenoxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
|---|---|
| PubChem CID | 46234751 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 8-chloro-1-[4-(3-methoxyphenoxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
| SMILES | COc1cccc(OC2CCC(c3nnc4n3-c3ccc(Cl)cc3CNC4)CC2)c1.Cl |
| InChI | InChI=1S/C23H25ClN4O2.ClH/c1-29-19-3-2-4-20(12-19)30-18-8-5-15(6-9-18)23-27-26-22-14-25-13-16-11-17(24)7-10-21(16)28(22)23;/h2-4,7,10-12,15,18,25H,5-6,8-9,13-14H2,1H3;1H |
| InChIKey | BERLGOYKHPZQKW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |