C20H25Cl2F3N4O — CID 68594571
8-chloro-1-[4-(4,4,4-trifluorobutan-2-yloxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride (PubChem CID 68594571) has the molecular formula C20H25Cl2F3N4O and a molecular weight of 465.35 g/mol. Its IUPAC name is 8-chloro-1-[4-(4,4,4-trifluorobutan-2-yloxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride.
| Compound Name | 8-chloro-1-[4-(4,4,4-trifluorobutan-2-yloxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
|---|---|
| PubChem CID | 68594571 |
| Molecular Formula | C20H25Cl2F3N4O |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 8-chloro-1-[4-(4,4,4-trifluorobutan-2-yloxy)cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
| SMILES | CC(CC(F)(F)F)OC1CCC(c2nnc3n2-c2ccc(Cl)cc2CNC3)CC1.Cl |
| InChI | InChI=1S/C20H24ClF3N4O.ClH/c1-12(9-20(22,23)24)29-16-5-2-13(3-6-16)19-27-26-18-11-25-10-14-8-15(21)4-7-17(14)28(18)19;/h4,7-8,12-13,16,25H,2-3,5-6,9-11H2,1H3;1H |
| InChIKey | LDVJZEBDGGISAC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |