C23H23Cl2F3N4O — CID 67421057
8-chloro-1-[4-[3-(trifluoromethyl)phenoxy]cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride (PubChem CID 67421057) has the molecular formula C23H23Cl2F3N4O and a molecular weight of 499.36 g/mol. Its IUPAC name is 8-chloro-1-[4-[3-(trifluoromethyl)phenoxy]cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride.
| Compound Name | 8-chloro-1-[4-[3-(trifluoromethyl)phenoxy]cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
|---|---|
| PubChem CID | 67421057 |
| Molecular Formula | C23H23Cl2F3N4O |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 8-chloro-1-[4-[3-(trifluoromethyl)phenoxy]cyclohexyl]-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(OC2CCC(c3nnc4n3-c3ccc(Cl)cc3CNC4)CC2)c1 |
| InChI | InChI=1S/C23H22ClF3N4O.ClH/c24-17-6-9-20-15(10-17)12-28-13-21-29-30-22(31(20)21)14-4-7-18(8-5-14)32-19-3-1-2-16(11-19)23(25,26)27;/h1-3,6,9-11,14,18,28H,4-5,7-8,12-13H2;1H |
| InChIKey | APJJEEPEBFPPCQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |