C22H26N6OS2 — CID 46234871
1-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea (PubChem CID 46234871) has the molecular formula C22H26N6OS2 and a molecular weight of 454.63 g/mol. Its IUPAC name is 1-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea.
| Compound Name | 1-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 46234871 |
| Molecular Formula | C22H26N6OS2 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-3-[(Z)-[(3E)-3-(methylcarbamothioylhydrazinylidene)butan-2-ylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(C)/C(C)=N\NC(=S)Nc1ccc(/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H26N6OS2/c1-15(25-27-21(30)23-3)16(2)26-28-22(31)24-19-11-7-17(8-12-19)5-6-18-9-13-20(29-4)14-10-18/h5-14H,1-4H3,(H2,23,27,30)(H2,24,28,31)/b6-5+,25-15+,26-16- |
| InChIKey | LVKDFGUBPJPOIG-BYEUZWNKSA-N |
| XLogP | 4.00 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|