C20H24N2O — CID 46236336
1,3-dimethyl-1-[1-(4-methylphenyl)-1-phenylbut-3-enyl]urea (PubChem CID 46236336) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1,3-dimethyl-1-[1-(4-methylphenyl)-1-phenylbut-3-enyl]urea.
| Compound Name | 1,3-dimethyl-1-[1-(4-methylphenyl)-1-phenylbut-3-enyl]urea |
|---|---|
| PubChem CID | 46236336 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1,3-dimethyl-1-[1-(4-methylphenyl)-1-phenylbut-3-enyl]urea |
| SMILES | C=CCC(c1ccccc1)(c1ccc(C)cc1)N(C)C(=O)NC |
| InChI | InChI=1S/C20H24N2O/c1-5-15-20(22(4)19(23)21-3,17-9-7-6-8-10-17)18-13-11-16(2)12-14-18/h5-14H,1,15H2,2-4H3,(H,21,23) |
| InChIKey | QXAKOHZYBMKETG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|