C25H25Cl2NO10P2 — CID 46237200
bis[(4-chlorophenyl)-dimethoxyphosphorylmethyl] pyridine-2,6-dicarboxylate (PubChem CID 46237200) has the molecular formula C25H25Cl2NO10P2 and a molecular weight of 632.33 g/mol. Its IUPAC name is bis[(4-chlorophenyl)-dimethoxyphosphorylmethyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(4-chlorophenyl)-dimethoxyphosphorylmethyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 46237200 |
| Molecular Formula | C25H25Cl2NO10P2 |
| Molecular Weight | 632.33 g/mol |
| Exact Mass | 631.03 |
| IUPAC Name | bis[(4-chlorophenyl)-dimethoxyphosphorylmethyl] pyridine-2,6-dicarboxylate |
| SMILES | COP(=O)(OC)C(OC(=O)c1cccc(C(=O)OC(c2ccc(Cl)cc2)P(=O)(OC)OC)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25Cl2NO10P2/c1-33-39(31,34-2)24(16-8-12-18(26)13-9-16)37-22(29)20-6-5-7-21(28-20)23(30)38-25(40(32,35-3)36-4)17-10-14-19(27)15-11-17/h5-15,24-25H,1-4H3 |
| InChIKey | KIECFRPADULHOV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 136.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.33 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|