C17H19FN2O2 — CID 46237558
(E)-N-(3-fluoropropoxymethoxy)-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine (PubChem CID 46237558) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is (E)-N-(3-fluoropropoxymethoxy)-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine.
| Compound Name | (E)-N-(3-fluoropropoxymethoxy)-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 46237558 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (E)-N-(3-fluoropropoxymethoxy)-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine |
| SMILES | FCCCOCO/N=C1/C=C(C#Cc2ccccn2)CCC1 |
| InChI | InChI=1S/C17H19FN2O2/c18-10-4-12-21-14-22-20-17-7-3-5-15(13-17)8-9-16-6-1-2-11-19-16/h1-2,6,11,13H,3-5,7,10,12,14H2/b20-17+ |
| InChIKey | YOQRPSJENXBPBZ-LVZFUZTISA-N |
| XLogP | 3.25 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|