C18H21FN2O2 — CID 46237676
(E)-N-[2-(2-fluoroethoxy)ethoxy]-3-[2-(6-methyl-2-pyridinyl)ethynyl]cyclohex-2-en-1-imine (PubChem CID 46237676) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-[2-(6-methyl-2-pyridinyl)ethynyl]cyclohex-2-en-1-imine.
| Compound Name | (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-[2-(6-methyl-2-pyridinyl)ethynyl]cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 46237676 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-[2-(6-methyl-2-pyridinyl)ethynyl]cyclohex-2-en-1-imine |
| SMILES | Cc1cccc(C#CC2=C/C(=N/OCCOCCF)CCC2)n1 |
| InChI | InChI=1S/C18H21FN2O2/c1-15-4-2-6-17(20-15)9-8-16-5-3-7-18(14-16)21-23-13-12-22-11-10-19/h2,4,6,14H,3,5,7,10-13H2,1H3/b21-18+ |
| InChIKey | IMUUOOJJUBUGGL-DYTRJAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|