C17H19FN2O2 — CID 46237675
(E)-N-[2-(2-fluoroethoxy)ethoxy]-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine (PubChem CID 46237675) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine.
| Compound Name | (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 46237675 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (E)-N-[2-(2-fluoroethoxy)ethoxy]-3-(2-pyridin-2-ylethynyl)cyclohex-2-en-1-imine |
| SMILES | FCCOCCO/N=C1/C=C(C#Cc2ccccn2)CCC1 |
| InChI | InChI=1S/C17H19FN2O2/c18-9-11-21-12-13-22-20-17-6-3-4-15(14-17)7-8-16-5-1-2-10-19-16/h1-2,5,10,14H,3-4,6,9,11-13H2/b20-17+ |
| InChIKey | IKBQPNVYXHKVJS-LVZFUZTISA-N |
| XLogP | 2.90 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|