C33H23ClFIN2O5 — CID 46238413
(3R,3'R,4'S,6'R,8'S,8'aS)-6'-(3-chloro-4-fluorophenyl)-5-iodo-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid (PubChem CID 46238413) has the molecular formula C33H23ClFIN2O5 and a molecular weight of 708.91 g/mol. Its IUPAC name is (3R,3'R,4'S,6'R,8'S,8'aS)-6'-(3-chloro-4-fluorophenyl)-5-iodo-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid.
| Compound Name | (3R,3'R,4'S,6'R,8'S,8'aS)-6'-(3-chloro-4-fluorophenyl)-5-iodo-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
|---|---|
| PubChem CID | 46238413 |
| Molecular Formula | C33H23ClFIN2O5 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.03 |
| IUPAC Name | (3R,3'R,4'S,6'R,8'S,8'aS)-6'-(3-chloro-4-fluorophenyl)-5-iodo-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
| SMILES | O=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)N2[C@H]1[C@@H](C(=O)O)[C@]1(C(=O)Nc3ccc(I)cc31)[C@H]2c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C33H23ClFIN2O5/c34-22-15-19(11-13-23(22)35)29-33(21-16-20(36)12-14-24(21)37-32(33)42)25(30(39)40)27-31(41)43-28(18-9-5-2-6-10-18)26(38(27)29)17-7-3-1-4-8-17/h1-16,25-29H,(H,37,42)(H,39,40)/t25-,26-,27-,28+,29+,33-/m0/s1 |
| InChIKey | FAEYFRKZLWSYKA-OYMLHXOGSA-N |
| XLogP | 6.44 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|