C27H26N2O7 — CID 46239038
[4-[(1E,6E)-7-[4-(1-aminocyclopropanecarbonyl)oxyphenyl]-4-hydroxy-3,5-dioxohepta-1,6-dienyl]phenyl] 1-aminocyclopropane-1-carboxylate (PubChem CID 46239038) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is [4-[(1E,6E)-7-[4-(1-aminocyclopropanecarbonyl)oxyphenyl]-4-hydroxy-3,5-dioxohepta-1,6-dienyl]phenyl] 1-aminocyclopropane-1-carboxylate.
| Compound Name | [4-[(1E,6E)-7-[4-(1-aminocyclopropanecarbonyl)oxyphenyl]-4-hydroxy-3,5-dioxohepta-1,6-dienyl]phenyl] 1-aminocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 46239038 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [4-[(1E,6E)-7-[4-(1-aminocyclopropanecarbonyl)oxyphenyl]-4-hydroxy-3,5-dioxohepta-1,6-dienyl]phenyl] 1-aminocyclopropane-1-carboxylate |
| SMILES | NC1(C(=O)Oc2ccc(/C=C/C(=O)C(O)C(=O)/C=C/c3ccc(OC(=O)C4(N)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H26N2O7/c28-26(13-14-26)24(33)35-19-7-1-17(2-8-19)5-11-21(30)23(32)22(31)12-6-18-3-9-20(10-4-18)36-25(34)27(29)15-16-27/h1-12,23,32H,13-16,28-29H2/b11-5+,12-6+ |
| InChIKey | WCOKHSXPLNUILD-YDWXAUTNSA-N |
| XLogP | 1.71 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|