C16H15F3O4 — CID 141222557
(E)-3-[4-(1,4,4-trifluorocyclohexanecarbonyl)oxyphenyl]prop-2-enoic acid (PubChem CID 141222557) has the molecular formula C16H15F3O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is (E)-3-[4-(1,4,4-trifluorocyclohexanecarbonyl)oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(1,4,4-trifluorocyclohexanecarbonyl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141222557 |
| Molecular Formula | C16H15F3O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (E)-3-[4-(1,4,4-trifluorocyclohexanecarbonyl)oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OC(=O)C2(F)CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C16H15F3O4/c17-15(7-9-16(18,19)10-8-15)14(22)23-12-4-1-11(2-5-12)3-6-13(20)21/h1-6H,7-10H2,(H,20,21)/b6-3+ |
| InChIKey | HHDSNSGEMWAOPH-ZZXKWVIFSA-N |
| XLogP | 3.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|