C22H28F2N4O2 — CID 46239582
5-[4-(difluoromethoxy)phenyl]-N-(4-methylcyclohexyl)-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 46239582) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-N-(4-methylcyclohexyl)-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-N-(4-methylcyclohexyl)-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 46239582 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-N-(4-methylcyclohexyl)-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CC1CCC(Nc2ncc(-c3ccc(OC(F)F)cc3)c(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C22H28F2N4O2/c1-15-2-6-17(7-3-15)26-22-25-14-19(20(27-22)28-10-12-29-13-11-28)16-4-8-18(9-5-16)30-21(23)24/h4-5,8-9,14-15,17,21H,2-3,6-7,10-13H2,1H3,(H,25,26,27) |
| InChIKey | MOQGLJNZYKHUPT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |