C25H26N4O — CID 46241383
5,7-bis(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 46241383) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 5,7-bis(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,7-bis(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46241383 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 5,7-bis(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc(-c2cn(-c3cccc(C)c3)c3ncnc(NC4CCOCC4)c23)c1 |
| InChI | InChI=1S/C25H26N4O/c1-17-5-3-7-19(13-17)22-15-29(21-8-4-6-18(2)14-21)25-23(22)24(26-16-27-25)28-20-9-11-30-12-10-20/h3-8,13-16,20H,9-12H2,1-2H3,(H,26,27,28) |
| InChIKey | ZCROBUXJDSDQLJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |