C22H28N4O — CID 46241294
5-butyl-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 46241294) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-butyl-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-butyl-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46241294 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 5-butyl-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCc1cn(-c2cccc(C)c2)c2ncnc(NC3CCOCC3)c12 |
| InChI | InChI=1S/C22H28N4O/c1-3-4-7-17-14-26(19-8-5-6-16(2)13-19)22-20(17)21(23-15-24-22)25-18-9-11-27-12-10-18/h5-6,8,13-15,18H,3-4,7,9-12H2,1-2H3,(H,23,24,25) |
| InChIKey | OXHPZSOBEJFPBN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |