C18H19IN4O — CID 59363547
5-iodo-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 59363547) has the molecular formula C18H19IN4O and a molecular weight of 434.28 g/mol. Its IUPAC name is 5-iodo-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-iodo-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59363547 |
| Molecular Formula | C18H19IN4O |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 5-iodo-7-(3-methylphenyl)-N-(oxan-4-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cccc(-n2cc(I)c3c(NC4CCOCC4)ncnc32)c1 |
| InChI | InChI=1S/C18H19IN4O/c1-12-3-2-4-14(9-12)23-10-15(19)16-17(20-11-21-18(16)23)22-13-5-7-24-8-6-13/h2-4,9-11,13H,5-8H2,1H3,(H,20,21,22) |
| InChIKey | FMEWQNACLWJGLJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|