C21H23NO3 — CID 46242764
(3R)-4-[(4-methoxyphenyl)methoxy]-3-quinolin-4-ylbutan-1-ol (PubChem CID 46242764) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3R)-4-[(4-methoxyphenyl)methoxy]-3-quinolin-4-ylbutan-1-ol.
| Compound Name | (3R)-4-[(4-methoxyphenyl)methoxy]-3-quinolin-4-ylbutan-1-ol |
|---|---|
| PubChem CID | 46242764 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3R)-4-[(4-methoxyphenyl)methoxy]-3-quinolin-4-ylbutan-1-ol |
| SMILES | COc1ccc(COC[C@H](CCO)c2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-24-18-8-6-16(7-9-18)14-25-15-17(11-13-23)19-10-12-22-21-5-3-2-4-20(19)21/h2-10,12,17,23H,11,13-15H2,1H3/t17-/m0/s1 |
| InChIKey | ICQVRIOTMXQXSU-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |