C20H24N4O6S — CID 46246486
N-(furan-2-ylmethyl)-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]propanamide (PubChem CID 46246486) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]propanamide |
|---|---|
| PubChem CID | 46246486 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]propanamide |
| SMILES | COCCCNC(=O)Cn1c(=O)n(CCC(=O)NCc2ccco2)c(=O)c2sccc21 |
| InChI | InChI=1S/C20H24N4O6S/c1-29-9-3-7-21-17(26)13-24-15-6-11-31-18(15)19(27)23(20(24)28)8-5-16(25)22-12-14-4-2-10-30-14/h2,4,6,10-11H,3,5,7-9,12-13H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | KEXKCGOVOQQFEO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|