C19H20FN3O4S — CID 46922848
2-[3-[(2-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 46922848) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[3-[(2-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[(2-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 46922848 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-[3-[(2-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1c(=O)n(Cc2ccccc2F)c(=O)c2sccc21 |
| InChI | InChI=1S/C19H20FN3O4S/c1-27-9-4-8-21-16(24)12-22-15-7-10-28-17(15)18(25)23(19(22)26)11-13-5-2-3-6-14(13)20/h2-3,5-7,10H,4,8-9,11-12H2,1H3,(H,21,24) |
| InChIKey | SLPFJULEWLJYDT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|