C19H21N3O5S — CID 6486363
2-[3-(3-methoxyphenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 6486363) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-[3-(3-methoxyphenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-(3-methoxyphenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 6486363 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-[3-(3-methoxyphenyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1c(=O)n(-c2cccc(OC)c2)c(=O)c2sccc21 |
| InChI | InChI=1S/C19H21N3O5S/c1-26-9-4-8-20-16(23)12-21-15-7-10-28-17(15)18(24)22(19(21)25)13-5-3-6-14(11-13)27-2/h3,5-7,10-11H,4,8-9,12H2,1-2H3,(H,20,23) |
| InChIKey | IBUUYCLXAZLGLS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|