C20H23N3O6S — CID 6486287
N-(2,4-dimethoxyphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 6486287) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 6486287 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | COCCCn1c(=O)c2sccc2n(CC(=O)Nc2ccc(OC)cc2OC)c1=O |
| InChI | InChI=1S/C20H23N3O6S/c1-27-9-4-8-22-19(25)18-15(7-10-30-18)23(20(22)26)12-17(24)21-14-6-5-13(28-2)11-16(14)29-3/h5-7,10-11H,4,8-9,12H2,1-3H3,(H,21,24) |
| InChIKey | LEPOYGPUKMSWEE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|