C18H17F2N3O4S — CID 6486318
N-(2,5-difluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide (PubChem CID 6486318) has the molecular formula C18H17F2N3O4S and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 6486318 |
| Molecular Formula | C18H17F2N3O4S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxothieno[3,2-d]pyrimidin-1-yl]acetamide |
| SMILES | COCCCn1c(=O)c2sccc2n(CC(=O)Nc2cc(F)ccc2F)c1=O |
| InChI | InChI=1S/C18H17F2N3O4S/c1-27-7-2-6-22-17(25)16-14(5-8-28-16)23(18(22)26)10-15(24)21-13-9-11(19)3-4-12(13)20/h3-5,8-9H,2,6-7,10H2,1H3,(H,21,24) |
| InChIKey | HLESYXXEXROKAD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|