C23H24FN3O5S — CID 46249691
N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-4-fluorobenzamide (PubChem CID 46249691) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-4-fluorobenzamide.
| Compound Name | N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 46249691 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-4-fluorobenzamide |
| SMILES | Cn1c(=O)c(=O)n(C)c2cc(S(=O)(=O)C3CCCCC3)c(NC(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C23H24FN3O5S/c1-26-18-12-17(25-21(28)14-8-10-15(24)11-9-14)20(13-19(18)27(2)23(30)22(26)29)33(31,32)16-6-4-3-5-7-16/h8-13,16H,3-7H2,1-2H3,(H,25,28) |
| InChIKey | PSPVJFGOLAAXBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|