C18H14N4O3 — CID 46253326
3-(4-methylphenyl)-4-(3-nitrophenyl)-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-6-one (PubChem CID 46253326) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4-(3-nitrophenyl)-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(4-methylphenyl)-4-(3-nitrophenyl)-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 46253326 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-(4-methylphenyl)-4-(3-nitrophenyl)-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-6-one |
| SMILES | Cc1ccc(-c2n[nH]c3c2C(c2cccc([N+](=O)[O-])c2)NC3=O)cc1 |
| InChI | InChI=1S/C18H14N4O3/c1-10-5-7-11(8-6-10)16-14-15(19-18(23)17(14)21-20-16)12-3-2-4-13(9-12)22(24)25/h2-9,15H,1H3,(H,19,23)(H,20,21) |
| InChIKey | CADHVGATJJKZED-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|