C23H26N4O5 — CID 78582389
5-(2,2-dimethoxyethyl)-4-(4-methylphenyl)-3-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one;methane (PubChem CID 78582389) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethyl)-4-(4-methylphenyl)-3-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one;methane.
| Compound Name | 5-(2,2-dimethoxyethyl)-4-(4-methylphenyl)-3-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one;methane |
|---|---|
| PubChem CID | 78582389 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-(2,2-dimethoxyethyl)-4-(4-methylphenyl)-3-(3-nitrophenyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one;methane |
| SMILES | C.COC(CN1C(=O)c2[nH]nc(-c3cccc([N+](=O)[O-])c3)c2C1c1ccc(C)cc1)OC |
| InChI | InChI=1S/C22H22N4O5.CH4/c1-13-7-9-14(10-8-13)21-18-19(15-5-4-6-16(11-15)26(28)29)23-24-20(18)22(27)25(21)12-17(30-2)31-3;/h4-11,17,21H,12H2,1-3H3,(H,23,24);1H4 |
| InChIKey | BTNUPVYCYNJGSA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|