C20H16Cl2N2O — CID 4625405
2-[benzyl(pyridin-2-yl)amino]-1-(3,4-dichlorophenyl)ethanone (PubChem CID 4625405) has the molecular formula C20H16Cl2N2O and a molecular weight of 371.27 g/mol. Its IUPAC name is 2-[benzyl(pyridin-2-yl)amino]-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-[benzyl(pyridin-2-yl)amino]-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 4625405 |
| Molecular Formula | C20H16Cl2N2O |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-[benzyl(pyridin-2-yl)amino]-1-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(CN(Cc1ccccc1)c1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O/c21-17-10-9-16(12-18(17)22)19(25)14-24(20-8-4-5-11-23-20)13-15-6-2-1-3-7-15/h1-12H,13-14H2 |
| InChIKey | KDUGKECHZWQPKJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |