C23H32FN3O4 — CID 46255206
N-(2,2-diethoxyethyl)-1-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide (PubChem CID 46255206) has the molecular formula C23H32FN3O4 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-1-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46255206 |
| Molecular Formula | C23H32FN3O4 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-[[2-(2-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCOC(CNC(=O)C1CCN(Cc2nc(-c3ccccc3F)oc2C)CC1)OCC |
| InChI | InChI=1S/C23H32FN3O4/c1-4-29-21(30-5-2)14-25-22(28)17-10-12-27(13-11-17)15-20-16(3)31-23(26-20)18-8-6-7-9-19(18)24/h6-9,17,21H,4-5,10-15H2,1-3H3,(H,25,28) |
| InChIKey | AYFODJODSXXGFQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|