C19H15N5O4 — CID 46256210
1-(3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-2-(4-nitrophenyl)ethanone (PubChem CID 46256210) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-(3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-(3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 46256210 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-(3-amino-7-methoxypyrazolo[5,4-b]quinolin-1-yl)-2-(4-nitrophenyl)ethanone |
| SMILES | COc1ccc2cc3c(N)nn(C(=O)Cc4ccc([N+](=O)[O-])cc4)c3nc2c1 |
| InChI | InChI=1S/C19H15N5O4/c1-28-14-7-4-12-9-15-18(20)22-23(19(15)21-16(12)10-14)17(25)8-11-2-5-13(6-3-11)24(26)27/h2-7,9-10H,8H2,1H3,(H2,20,22) |
| InChIKey | QZGUGXUAWFGMRH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|