C18H22N2O2 — CID 4625749
2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 4625749) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
| Compound Name | 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
|---|---|
| PubChem CID | 4625749 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | CCCCCCCc1nc2c(=O)n(C)c3ccccc3c2o1 |
| InChI | InChI=1S/C18H22N2O2/c1-3-4-5-6-7-12-15-19-16-17(22-15)13-10-8-9-11-14(13)20(2)18(16)21/h8-11H,3-7,12H2,1-2H3 |
| InChIKey | ZOFAHVCXOGYZNT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|