About 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one
2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 4625749) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| PubChem CID | 4625749 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | CCCCCCCc1nc2c(=O)n(C)c3ccccc3c2o1 |
| InChI | InChI=1S/C18H22N2O2/c1-3-4-5-6-7-12-15-19-16-17(22-15)13-10-8-9-11-14(13)20(2)18(16)21/h8-11H,3-7,12H2,1-2H3 |
| InChIKey | ZOFAHVCXOGYZNT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The IUPAC name of 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one (CID 4625749) is 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
What is the SMILES notation for 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The canonical SMILES for 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one is CCCCCCCc1nc2c(=O)n(C)c3ccccc3c2o1.
What is the InChIKey of 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The InChIKey is ZOFAHVCXOGYZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-3-4-5-6-7-12-15-19-16-17(22-15)13-10-8-9-11-14(13)20(2)18(16)21/h8-11H,3-7,12H2,1-2H3.
What are the key properties of 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one has a molecular weight of 298.39 g/mol, XLogP of 4.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-5-methyl-[1,3]oxazolo[4,5-c]quinolin-4-one is sourced from PubChem (CID 4625749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).