C26H25N7O3S2 — CID 46258207
(6E)-2-cyclohexyl-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 46258207) has the molecular formula C26H25N7O3S2 and a molecular weight of 547.67 g/mol. Its IUPAC name is (6E)-2-cyclohexyl-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-2-cyclohexyl-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46258207 |
| Molecular Formula | C26H25N7O3S2 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (6E)-2-cyclohexyl-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2ccc(OCc3cc(=O)n4nc(CC)sc4n3)cc2)/C(=O)N=C2SC(C3CCCCC3)=NN2/1 |
| InChI | InChI=1S/C26H25N7O3S2/c1-2-20-30-32-21(34)13-17(28-25(32)37-20)14-36-18-10-8-15(9-11-18)12-19-22(27)33-26(29-23(19)35)38-24(31-33)16-6-4-3-5-7-16/h8-13,16,27H,2-7,14H2,1H3/b19-12+,27-22- |
| InChIKey | CRYMXXMNCLFQEF-AHDVGTACSA-N |
| XLogP | 4.49 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|