C25H25N7O3S2 — CID 56727899
(6Z)-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727899) has the molecular formula C25H25N7O3S2 and a molecular weight of 535.66 g/mol. Its IUPAC name is (6Z)-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727899 |
| Molecular Formula | C25H25N7O3S2 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | (6Z)-6-[[4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]-5-imino-2-pentan-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCc3cc(=O)n4nc(CC)sc4n3)cc2)/C(=O)N=C2SC(C(CC)CC)=NN2/1 |
| InChI | InChI=1S/C25H25N7O3S2/c1-4-15(5-2)23-30-32-21(26)18(22(34)28-25(32)37-23)11-14-7-9-17(10-8-14)35-13-16-12-20(33)31-24(27-16)36-19(6-3)29-31/h7-12,15,26H,4-6,13H2,1-3H3/b18-11-,26-21- |
| InChIKey | CRSRAANRQPBYLX-HMQCCPTKSA-N |
| XLogP | 4.35 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|