C28H29N3O3S — CID 46258509
4-tert-butyl-N-[3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methoxy]phenyl]benzamide (PubChem CID 46258509) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methoxy]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 46258509 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-tert-butyl-N-[3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methoxy]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(OCc3cc(=O)n4c5c(sc4n3)CCCC5)c2)cc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-28(2,3)19-13-11-18(12-14-19)26(33)29-20-7-6-8-22(15-20)34-17-21-16-25(32)31-23-9-4-5-10-24(23)35-27(31)30-21/h6-8,11-16H,4-5,9-10,17H2,1-3H3,(H,29,33) |
| InChIKey | BQBJVUCQYCKSEJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |