C25H22N2O3S — CID 20946545
(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2,2-diphenylacetate (PubChem CID 20946545) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2,2-diphenylacetate.
| Compound Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 20946545 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 2,2-diphenylacetate |
| SMILES | O=C(OCc1cc(=O)n2c3c(sc2n1)CCCC3)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O3S/c28-22-15-19(26-25-27(22)20-13-7-8-14-21(20)31-25)16-30-24(29)23(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,15,23H,7-8,13-14,16H2 |
| InChIKey | YDQUCJLPJTXFLA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |