C23H32N4OS+2 — CID 8773987
diethyl-[(2R)-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylazaniumyl]-2-phenylethyl]azanium (PubChem CID 8773987) has the molecular formula C23H32N4OS+2 and a molecular weight of 412.60 g/mol. Its IUPAC name is diethyl-[(2R)-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylazaniumyl]-2-phenylethyl]azanium.
| Compound Name | diethyl-[(2R)-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylazaniumyl]-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 8773987 |
| Molecular Formula | C23H32N4OS+2 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | diethyl-[(2R)-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylazaniumyl]-2-phenylethyl]azanium |
| SMILES | CC[NH+](CC)C[C@H]([NH2+]Cc1cc(=O)n2c3c(sc2n1)CCCC3)c1ccccc1 |
| InChI | InChI=1S/C23H30N4OS/c1-3-26(4-2)16-19(17-10-6-5-7-11-17)24-15-18-14-22(28)27-20-12-8-9-13-21(20)29-23(27)25-18/h5-7,10-11,14,19,24H,3-4,8-9,12-13,15-16H2,1-2H3/p+2/t19-/m0/s1 |
| InChIKey | FWXQVDLLWMFKFR-IBGZPJMESA-P |
| XLogP | 1.36 |
| TPSA | 55.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |