C21H18Cl2N4O3S — CID 24556958
5-(2,4-dichlorophenyl)-5-methyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 24556958) has the molecular formula C21H18Cl2N4O3S and a molecular weight of 477.37 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-methyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24556958 |
| Molecular Formula | C21H18Cl2N4O3S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-5-methyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)cc2Cl)NC(=O)N(Cc2cc(=O)n3c4c(sc3n2)CCCC4)C1=O |
| InChI | InChI=1S/C21H18Cl2N4O3S/c1-21(13-7-6-11(22)8-14(13)23)18(29)26(19(30)25-21)10-12-9-17(28)27-15-4-2-3-5-16(15)31-20(27)24-12/h6-9H,2-5,10H2,1H3,(H,25,30) |
| InChIKey | ZOXFYQRQWLTMAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|