C22H21ClN4O3S — CID 24556962
5-(4-chlorophenyl)-5-ethyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 24556962) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-5-ethyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-5-ethyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24556962 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 5-(4-chlorophenyl)-5-ethyl-3-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(Cc2cc(=O)n3c4c(sc3n2)CCCC4)C1=O |
| InChI | InChI=1S/C22H21ClN4O3S/c1-2-22(13-7-9-14(23)10-8-13)19(29)26(20(30)25-22)12-15-11-18(28)27-16-5-3-4-6-17(16)31-21(27)24-15/h7-11H,2-6,12H2,1H3,(H,25,30) |
| InChIKey | KWGYDEDJXCRDTM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|