C21H22N4O3S — CID 24577741
5-butyl-3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 24577741) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 5-butyl-3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-butyl-3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24577741 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 5-butyl-3-[(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(Cc2cc(=O)n3c(C)csc3n2)C1=O |
| InChI | InChI=1S/C21H22N4O3S/c1-3-4-10-21(15-8-6-5-7-9-15)18(27)24(19(28)23-21)12-16-11-17(26)25-14(2)13-29-20(25)22-16/h5-9,11,13H,3-4,10,12H2,1-2H3,(H,23,28) |
| InChIKey | VGLYSZQNMICKKD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|