C25H21N3O4S2 — CID 46336504
N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46336504) has the molecular formula C25H21N3O4S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46336504 |
| Molecular Formula | C25H21N3O4S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | N-[2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1SCc1cc(=O)n2c3c(sc2n1)CCCC3)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H21N3O4S2/c29-23-12-16(26-25-28(23)18-6-2-4-8-22(18)34-25)13-33-21-7-3-1-5-17(21)27-24(30)15-9-10-19-20(11-15)32-14-31-19/h1,3,5,7,9-12H,2,4,6,8,13-14H2,(H,27,30) |
| InChIKey | FJCJWHMVYFYTBQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |