C23H25N3O4S — CID 46343564
(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-(3-methylbutanoylamino)benzoate (PubChem CID 46343564) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-(3-methylbutanoylamino)benzoate.
| Compound Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-(3-methylbutanoylamino)benzoate |
|---|---|
| PubChem CID | 46343564 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methyl 4-(3-methylbutanoylamino)benzoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)OCc2cc(=O)n3c4c(sc3n2)CCCC4)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-14(2)11-20(27)24-16-9-7-15(8-10-16)22(29)30-13-17-12-21(28)26-18-5-3-4-6-19(18)31-23(26)25-17/h7-10,12,14H,3-6,11,13H2,1-2H3,(H,24,27) |
| InChIKey | KOFXSZDMWQNOBA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |