C25H18N4O4S — CID 46262324
[2-amino-1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]indolizin-3-yl]-(3-nitrophenyl)methanone (PubChem CID 46262324) has the molecular formula C25H18N4O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is [2-amino-1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]indolizin-3-yl]-(3-nitrophenyl)methanone.
| Compound Name | [2-amino-1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]indolizin-3-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46262324 |
| Molecular Formula | C25H18N4O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [2-amino-1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]indolizin-3-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccccc1-c1csc(-c2c(N)c(C(=O)c3cccc([N+](=O)[O-])c3)n3ccccc23)n1 |
| InChI | InChI=1S/C25H18N4O4S/c1-33-20-11-3-2-9-17(20)18-14-34-25(27-18)21-19-10-4-5-12-28(19)23(22(21)26)24(30)15-7-6-8-16(13-15)29(31)32/h2-14H,26H2,1H3 |
| InChIKey | XZDWXCBAHAJWAN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|