C21H14N4O5S — CID 2331531
5-[[2-methyl-3-(3-nitrobenzoyl)indolizin-1-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 2331531) has the molecular formula C21H14N4O5S and a molecular weight of 434.43 g/mol. Its IUPAC name is 5-[[2-methyl-3-(3-nitrobenzoyl)indolizin-1-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[2-methyl-3-(3-nitrobenzoyl)indolizin-1-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 2331531 |
| Molecular Formula | C21H14N4O5S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 5-[[2-methyl-3-(3-nitrobenzoyl)indolizin-1-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1c(C=C2C(=O)NC(=S)NC2=O)c2ccccn2c1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N4O5S/c1-11-14(10-15-19(27)22-21(31)23-20(15)28)16-7-2-3-8-24(16)17(11)18(26)12-5-4-6-13(9-12)25(29)30/h2-10H,1H3,(H2,22,23,27,28,31) |
| InChIKey | FJSLKEPNTAAFGQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|