C22H19N3O5 — CID 2329209
[1-(cyclohexen-1-yl)-2-methylindolizin-3-yl]-(3,5-dinitrophenyl)methanone (PubChem CID 2329209) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-2-methylindolizin-3-yl]-(3,5-dinitrophenyl)methanone.
| Compound Name | [1-(cyclohexen-1-yl)-2-methylindolizin-3-yl]-(3,5-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 2329209 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [1-(cyclohexen-1-yl)-2-methylindolizin-3-yl]-(3,5-dinitrophenyl)methanone |
| SMILES | Cc1c(C2=CCCCC2)c2ccccn2c1C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19N3O5/c1-14-20(15-7-3-2-4-8-15)19-9-5-6-10-23(19)21(14)22(26)16-11-17(24(27)28)13-18(12-16)25(29)30/h5-7,9-13H,2-4,8H2,1H3 |
| InChIKey | ALYCVBXZECOTPX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 107.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|