C16H12N6O6 — CID 27699260
N'-(3,5-dinitrobenzoyl)-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide (PubChem CID 27699260) has the molecular formula C16H12N6O6 and a molecular weight of 384.31 g/mol. Its IUPAC name is N'-(3,5-dinitrobenzoyl)-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide.
| Compound Name | N'-(3,5-dinitrobenzoyl)-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 27699260 |
| Molecular Formula | C16H12N6O6 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N'-(3,5-dinitrobenzoyl)-2-methylimidazo[1,2-a]pyridine-3-carbohydrazide |
| SMILES | Cc1nc2ccccn2c1C(=O)NNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N6O6/c1-9-14(20-5-3-2-4-13(20)17-9)16(24)19-18-15(23)10-6-11(21(25)26)8-12(7-10)22(27)28/h2-8H,1H3,(H,18,23)(H,19,24) |
| InChIKey | AROZKJXLTHZXRV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|