C18H27N5O2 — CID 51659196
1-[(2S)-6-methylheptan-2-yl]-3-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]urea (PubChem CID 51659196) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[(2S)-6-methylheptan-2-yl]-3-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]urea.
| Compound Name | 1-[(2S)-6-methylheptan-2-yl]-3-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 51659196 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[(2S)-6-methylheptan-2-yl]-3-[(2-methylimidazo[1,2-a]pyridine-3-carbonyl)amino]urea |
| SMILES | Cc1nc2ccccn2c1C(=O)NNC(=O)N[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C18H27N5O2/c1-12(2)8-7-9-13(3)19-18(25)22-21-17(24)16-14(4)20-15-10-5-6-11-23(15)16/h5-6,10-13H,7-9H2,1-4H3,(H,21,24)(H2,19,22,25)/t13-/m0/s1 |
| InChIKey | IOACMWNBAYWIIH-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|