C20H14N4O2S2 — CID 24502809
2-methyl-N'-(thieno[3,2-b][1]benzothiole-2-carbonyl)imidazo[1,2-a]pyridine-3-carbohydrazide (PubChem CID 24502809) has the molecular formula C20H14N4O2S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-methyl-N'-(thieno[3,2-b][1]benzothiole-2-carbonyl)imidazo[1,2-a]pyridine-3-carbohydrazide.
| Compound Name | 2-methyl-N'-(thieno[3,2-b][1]benzothiole-2-carbonyl)imidazo[1,2-a]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24502809 |
| Molecular Formula | C20H14N4O2S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2-methyl-N'-(thieno[3,2-b][1]benzothiole-2-carbonyl)imidazo[1,2-a]pyridine-3-carbohydrazide |
| SMILES | Cc1nc2ccccn2c1C(=O)NNC(=O)c1cc2sc3ccccc3c2s1 |
| InChI | InChI=1S/C20H14N4O2S2/c1-11-17(24-9-5-4-8-16(24)21-11)20(26)23-22-19(25)15-10-14-18(28-15)12-6-2-3-7-13(12)27-14/h2-10H,1H3,(H,22,25)(H,23,26) |
| InChIKey | WPGQVESRWJCUQB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|