C29H16N4O9 — CID 10030781
[2,3-bis(4-nitrobenzoyl)indolizin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 10030781) has the molecular formula C29H16N4O9 and a molecular weight of 564.47 g/mol. Its IUPAC name is [2,3-bis(4-nitrobenzoyl)indolizin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [2,3-bis(4-nitrobenzoyl)indolizin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 10030781 |
| Molecular Formula | C29H16N4O9 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | [2,3-bis(4-nitrobenzoyl)indolizin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1c(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccccn2c1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H16N4O9/c34-27(17-4-10-20(11-5-17)31(37)38)24-23-3-1-2-16-30(23)26(29(36)19-8-14-22(15-9-19)33(41)42)25(24)28(35)18-6-12-21(13-7-18)32(39)40/h1-16H |
| InChIKey | YPQOPHPVGIKBRU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 185.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|