C31H20N2O2S — CID 4626405
[4-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenyl] naphthalene-1-carboxylate (PubChem CID 4626405) has the molecular formula C31H20N2O2S and a molecular weight of 484.58 g/mol. Its IUPAC name is [4-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 4626405 |
| Molecular Formula | C31H20N2O2S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | [4-[[3-(1,3-benzothiazol-2-yl)phenyl]iminomethyl]phenyl] naphthalene-1-carboxylate |
| SMILES | O=C(Oc1ccc(/C=N/c2cccc(-c3nc4ccccc4s3)c2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C31H20N2O2S/c34-31(27-12-6-8-22-7-1-2-11-26(22)27)35-25-17-15-21(16-18-25)20-32-24-10-5-9-23(19-24)30-33-28-13-3-4-14-29(28)36-30/h1-20H/b32-20+ |
| InChIKey | WJWOEFQKUGZYIB-UZWMFBFFSA-N |
| XLogP | 8.09 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|