C22H28N4OS — CID 46265407
N-butyl-2-[2-[3,5-dimethyl-4-[(4-methylphenyl)methyl]pyrazol-1-yl]-1,3-thiazol-4-yl]acetamide (PubChem CID 46265407) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is N-butyl-2-[2-[3,5-dimethyl-4-[(4-methylphenyl)methyl]pyrazol-1-yl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-butyl-2-[2-[3,5-dimethyl-4-[(4-methylphenyl)methyl]pyrazol-1-yl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46265407 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-butyl-2-[2-[3,5-dimethyl-4-[(4-methylphenyl)methyl]pyrazol-1-yl]-1,3-thiazol-4-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1csc(-n2nc(C)c(Cc3ccc(C)cc3)c2C)n1 |
| InChI | InChI=1S/C22H28N4OS/c1-5-6-11-23-21(27)13-19-14-28-22(24-19)26-17(4)20(16(3)25-26)12-18-9-7-15(2)8-10-18/h7-10,14H,5-6,11-13H2,1-4H3,(H,23,27) |
| InChIKey | FSYLHXGXIOIOEE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|